C16H13ClOS — CID 123804668
3-(3-chlorophenyl)sulfanyl-2,5-dimethyl-1-benzofuran (PubChem CID 123804668) has the molecular formula C16H13ClOS and a molecular weight of 288.80 g/mol. Its IUPAC name is 3-(3-chlorophenyl)sulfanyl-2,5-dimethyl-1-benzofuran.
| Compound Name | 3-(3-chlorophenyl)sulfanyl-2,5-dimethyl-1-benzofuran |
|---|---|
| PubChem CID | 123804668 |
| Molecular Formula | C16H13ClOS |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 3-(3-chlorophenyl)sulfanyl-2,5-dimethyl-1-benzofuran |
| SMILES | Cc1ccc2oc(C)c(Sc3cccc(Cl)c3)c2c1 |
| InChI | InChI=1S/C16H13ClOS/c1-10-6-7-15-14(8-10)16(11(2)18-15)19-13-5-3-4-12(17)9-13/h3-9H,1-2H3 |
| InChIKey | OBRHFRIDXGNTJI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |