C17H18S2Si — CID 102189384
trimethyl-(3-phenylsulfanyl-1-benzothiophen-2-yl)silane (PubChem CID 102189384) has the molecular formula C17H18S2Si and a molecular weight of 314.55 g/mol. Its IUPAC name is trimethyl-(3-phenylsulfanyl-1-benzothiophen-2-yl)silane.
| Compound Name | trimethyl-(3-phenylsulfanyl-1-benzothiophen-2-yl)silane |
|---|---|
| PubChem CID | 102189384 |
| Molecular Formula | C17H18S2Si |
| Molecular Weight | 314.55 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | trimethyl-(3-phenylsulfanyl-1-benzothiophen-2-yl)silane |
| SMILES | C[Si](C)(C)c1sc2ccccc2c1Sc1ccccc1 |
| InChI | InChI=1S/C17H18S2Si/c1-20(2,3)17-16(18-13-9-5-4-6-10-13)14-11-7-8-12-15(14)19-17/h4-12H,1-3H3 |
| InChIKey | FMUYXBFLVUHQAC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|