C23H24O2SSi — CID 122391065
[3-(hydroxymethyl)-1-phenyl-4-trimethylsilyldibenzothiophen-2-yl]methanol (PubChem CID 122391065) has the molecular formula C23H24O2SSi and a molecular weight of 392.60 g/mol. Its IUPAC name is [3-(hydroxymethyl)-1-phenyl-4-trimethylsilyldibenzothiophen-2-yl]methanol.
| Compound Name | [3-(hydroxymethyl)-1-phenyl-4-trimethylsilyldibenzothiophen-2-yl]methanol |
|---|---|
| PubChem CID | 122391065 |
| Molecular Formula | C23H24O2SSi |
| Molecular Weight | 392.60 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | [3-(hydroxymethyl)-1-phenyl-4-trimethylsilyldibenzothiophen-2-yl]methanol |
| SMILES | C[Si](C)(C)c1c(CO)c(CO)c(-c2ccccc2)c2c1sc1ccccc12 |
| InChI | InChI=1S/C23H24O2SSi/c1-27(2,3)23-18(14-25)17(13-24)20(15-9-5-4-6-10-15)21-16-11-7-8-12-19(16)26-22(21)23/h4-12,24-25H,13-14H2,1-3H3 |
| InChIKey | OCIGJYKPLLDOGD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|