C10H10S3 — CID 11009677
2,3-bis(methylsulfanyl)-1-benzothiophene (PubChem CID 11009677) has the molecular formula C10H10S3 and a molecular weight of 226.39 g/mol. Its IUPAC name is 2,3-bis(methylsulfanyl)-1-benzothiophene.
| Compound Name | 2,3-bis(methylsulfanyl)-1-benzothiophene |
|---|---|
| PubChem CID | 11009677 |
| Molecular Formula | C10H10S3 |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | 2,3-bis(methylsulfanyl)-1-benzothiophene |
| SMILES | CSc1sc2ccccc2c1SC |
| InChI | InChI=1S/C10H10S3/c1-11-9-7-5-3-4-6-8(7)13-10(9)12-2/h3-6H,1-2H3 |
| InChIKey | WYAVCNJNUOGKMN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |