About dibenzothiophene;ethane;molecular hydrogen
dibenzothiophene;ethane;molecular hydrogen (PubChem CID 145320534) has the molecular formula C14H16S
and a molecular weight of 216.35 g/mol. Its IUPAC name is dibenzothiophene;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | dibenzothiophene;ethane;molecular hydrogen |
| PubChem CID | 145320534 |
| Molecular Formula | C14H16S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | dibenzothiophene;ethane;molecular hydrogen |
| SMILES | CC.[H][H].c1ccc2c(c1)sc1ccccc12 |
| InChI | InChI=1S/C12H8S.C2H6.H2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2;/h1-8H;1-2H3;1H |
| InChIKey | GELOZXINHSJJGM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dibenzothiophene;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzothiophene;ethane;molecular hydrogen?
The IUPAC name of dibenzothiophene;ethane;molecular hydrogen (CID 145320534) is dibenzothiophene;ethane;molecular hydrogen.
What is the SMILES notation for dibenzothiophene;ethane;molecular hydrogen?
The canonical SMILES for dibenzothiophene;ethane;molecular hydrogen is CC.[H][H].c1ccc2c(c1)sc1ccccc12.
What is the InChIKey of dibenzothiophene;ethane;molecular hydrogen?
The InChIKey is GELOZXINHSJJGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8S.C2H6.H2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2;/h1-8H;1-2H3;1H.
What are the key properties of dibenzothiophene;ethane;molecular hydrogen?
dibenzothiophene;ethane;molecular hydrogen has a molecular weight of 216.35 g/mol, XLogP of 5.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzothiophene;ethane;molecular hydrogen is sourced from PubChem (CID 145320534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).