dibenzothiophene;ethane;molecular hydrogen

C14H16S — CID 145320534

IUPACdibenzothiophene;ethane;molecular hydrogen
SMILESCC.[H][H].c1ccc2c(c1)sc1ccccc12
InChIInChI=1S/C12H8S.C2H6.H2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2;/h1-8H;1-2H3;1H
InChIKeyGELOZXINHSJJGM-UHFFFAOYSA-N
MW216.35 g/mol
LogP5.33
Rot. Bonds

About dibenzothiophene;ethane;molecular hydrogen

dibenzothiophene;ethane;molecular hydrogen (PubChem CID 145320534) has the molecular formula C14H16S and a molecular weight of 216.35 g/mol. Its IUPAC name is dibenzothiophene;ethane;molecular hydrogen.

Molecular Properties

Compound Namedibenzothiophene;ethane;molecular hydrogen
PubChem CID145320534
Molecular FormulaC14H16S
Molecular Weight216.35 g/mol
Exact Mass216.10
IUPAC Namedibenzothiophene;ethane;molecular hydrogen
SMILESCC.[H][H].c1ccc2c(c1)sc1ccccc12
InChIInChI=1S/C12H8S.C2H6.H2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2;/h1-8H;1-2H3;1H
InChIKeyGELOZXINHSJJGM-UHFFFAOYSA-N
XLogP5.33
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms15
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500216.35
LogP ≤ 55.33
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze dibenzothiophene;ethane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dibenzothiophene;ethane;molecular hydrogen?
The IUPAC name of dibenzothiophene;ethane;molecular hydrogen (CID 145320534) is dibenzothiophene;ethane;molecular hydrogen.
What is the SMILES notation for dibenzothiophene;ethane;molecular hydrogen?
The canonical SMILES for dibenzothiophene;ethane;molecular hydrogen is CC.[H][H].c1ccc2c(c1)sc1ccccc12.
What is the InChIKey of dibenzothiophene;ethane;molecular hydrogen?
The InChIKey is GELOZXINHSJJGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8S.C2H6.H2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2;/h1-8H;1-2H3;1H.
What are the key properties of dibenzothiophene;ethane;molecular hydrogen?
dibenzothiophene;ethane;molecular hydrogen has a molecular weight of 216.35 g/mol, XLogP of 5.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzothiophene;ethane;molecular hydrogen is sourced from PubChem (CID 145320534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).