About dibenzothiophene;methane
dibenzothiophene;methane (PubChem CID 162233710) has the molecular formula C14H16S
and a molecular weight of 216.35 g/mol. Its IUPAC name is dibenzothiophene;methane.
Molecular Properties
| Compound Name | dibenzothiophene;methane |
| PubChem CID | 162233710 |
| Molecular Formula | C14H16S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | dibenzothiophene;methane |
| SMILES | C.C.c1ccc2c(c1)sc1ccccc12 |
| InChI | InChI=1S/C12H8S.2CH4/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;;/h1-8H;2*1H4 |
| InChIKey | ZVTZVTWUXQJXFR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dibenzothiophene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzothiophene;methane?
The IUPAC name of dibenzothiophene;methane (CID 162233710) is dibenzothiophene;methane.
What is the SMILES notation for dibenzothiophene;methane?
The canonical SMILES for dibenzothiophene;methane is C.C.c1ccc2c(c1)sc1ccccc12.
What is the InChIKey of dibenzothiophene;methane?
The InChIKey is ZVTZVTWUXQJXFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8S.2CH4/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;;/h1-8H;2*1H4.
What are the key properties of dibenzothiophene;methane?
dibenzothiophene;methane has a molecular weight of 216.35 g/mol, XLogP of 5.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzothiophene;methane is sourced from PubChem (CID 162233710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).