About [bromo(phenyl)phosphoryl]benzene;dibenzothiophene
[bromo(phenyl)phosphoryl]benzene;dibenzothiophene (PubChem CID 174853567) has the molecular formula C24H18BrOPS
and a molecular weight of 465.35 g/mol. Its IUPAC name is [bromo(phenyl)phosphoryl]benzene;dibenzothiophene.
Molecular Properties
| Compound Name | [bromo(phenyl)phosphoryl]benzene;dibenzothiophene |
| PubChem CID | 174853567 |
| Molecular Formula | C24H18BrOPS |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | [bromo(phenyl)phosphoryl]benzene;dibenzothiophene |
| SMILES | O=P(Br)(c1ccccc1)c1ccccc1.c1ccc2c(c1)sc1ccccc12 |
| InChI | InChI=1S/C12H10BrOP.C12H8S/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-10H;1-8H |
| InChIKey | HAXJTJUGNXPUAY-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [bromo(phenyl)phosphoryl]benzene;dibenzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [bromo(phenyl)phosphoryl]benzene;dibenzothiophene?
The IUPAC name of [bromo(phenyl)phosphoryl]benzene;dibenzothiophene (CID 174853567) is [bromo(phenyl)phosphoryl]benzene;dibenzothiophene.
What is the SMILES notation for [bromo(phenyl)phosphoryl]benzene;dibenzothiophene?
The canonical SMILES for [bromo(phenyl)phosphoryl]benzene;dibenzothiophene is O=P(Br)(c1ccccc1)c1ccccc1.c1ccc2c(c1)sc1ccccc12.
What is the InChIKey of [bromo(phenyl)phosphoryl]benzene;dibenzothiophene?
The InChIKey is HAXJTJUGNXPUAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrOP.C12H8S/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-10H;1-8H.
What are the key properties of [bromo(phenyl)phosphoryl]benzene;dibenzothiophene?
[bromo(phenyl)phosphoryl]benzene;dibenzothiophene has a molecular weight of 465.35 g/mol, XLogP of 7.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [bromo(phenyl)phosphoryl]benzene;dibenzothiophene is sourced from PubChem (CID 174853567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).