About dibenzothiophene;formaldehyde
dibenzothiophene;formaldehyde (PubChem CID 20556925) has the molecular formula C13H10OS
and a molecular weight of 214.29 g/mol. Its IUPAC name is dibenzothiophene;formaldehyde.
Molecular Properties
| Compound Name | dibenzothiophene;formaldehyde |
| PubChem CID | 20556925 |
| Molecular Formula | C13H10OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | dibenzothiophene;formaldehyde |
| SMILES | C=O.c1ccc2c(c1)sc1ccccc12 |
| InChI | InChI=1S/C12H8S.CH2O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2/h1-8H;1H2 |
| InChIKey | KGEUSEKMSUSZPA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dibenzothiophene;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzothiophene;formaldehyde?
The IUPAC name of dibenzothiophene;formaldehyde (CID 20556925) is dibenzothiophene;formaldehyde.
What is the SMILES notation for dibenzothiophene;formaldehyde?
The canonical SMILES for dibenzothiophene;formaldehyde is C=O.c1ccc2c(c1)sc1ccccc12.
What is the InChIKey of dibenzothiophene;formaldehyde?
The InChIKey is KGEUSEKMSUSZPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8S.CH2O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2/h1-8H;1H2.
What are the key properties of dibenzothiophene;formaldehyde?
dibenzothiophene;formaldehyde has a molecular weight of 214.29 g/mol, XLogP of 3.87, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzothiophene;formaldehyde is sourced from PubChem (CID 20556925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).