About 2-bromodibenzothiophene;dibenzothiophene
2-bromodibenzothiophene;dibenzothiophene (PubChem CID 158379286) has the molecular formula C24H15BrS2
and a molecular weight of 447.42 g/mol. Its IUPAC name is 2-bromodibenzothiophene;dibenzothiophene.
Molecular Properties
| Compound Name | 2-bromodibenzothiophene;dibenzothiophene |
| PubChem CID | 158379286 |
| Molecular Formula | C24H15BrS2 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 445.98 |
| IUPAC Name | 2-bromodibenzothiophene;dibenzothiophene |
| SMILES | Brc1ccc2sc3ccccc3c2c1.c1ccc2c(c1)sc1ccccc12 |
| InChI | InChI=1S/C12H7BrS.C12H8S/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-7H;1-8H |
| InChIKey | GVOXPRXWXBRQDB-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromodibenzothiophene;dibenzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromodibenzothiophene;dibenzothiophene?
The IUPAC name of 2-bromodibenzothiophene;dibenzothiophene (CID 158379286) is 2-bromodibenzothiophene;dibenzothiophene.
What is the SMILES notation for 2-bromodibenzothiophene;dibenzothiophene?
The canonical SMILES for 2-bromodibenzothiophene;dibenzothiophene is Brc1ccc2sc3ccccc3c2c1.c1ccc2c(c1)sc1ccccc12.
What is the InChIKey of 2-bromodibenzothiophene;dibenzothiophene?
The InChIKey is GVOXPRXWXBRQDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrS.C12H8S/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-7H;1-8H.
What are the key properties of 2-bromodibenzothiophene;dibenzothiophene?
2-bromodibenzothiophene;dibenzothiophene has a molecular weight of 447.42 g/mol, XLogP of 8.87, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromodibenzothiophene;dibenzothiophene is sourced from PubChem (CID 158379286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).