About aniline;thioxanthen-9-one
aniline;thioxanthen-9-one (PubChem CID 157172339) has the molecular formula C19H15NOS
and a molecular weight of 305.40 g/mol. Its IUPAC name is aniline;thioxanthen-9-one.
Molecular Properties
| Compound Name | aniline;thioxanthen-9-one |
| PubChem CID | 157172339 |
| Molecular Formula | C19H15NOS |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | aniline;thioxanthen-9-one |
| SMILES | Nc1ccccc1.O=c1c2ccccc2sc2ccccc12 |
| InChI | InChI=1S/C13H8OS.C6H7N/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;7-6-4-2-1-3-5-6/h1-8H;1-5H,7H2 |
| InChIKey | ANPQYXPQZDCHQW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze aniline;thioxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;thioxanthen-9-one?
The IUPAC name of aniline;thioxanthen-9-one (CID 157172339) is aniline;thioxanthen-9-one.
What is the SMILES notation for aniline;thioxanthen-9-one?
The canonical SMILES for aniline;thioxanthen-9-one is Nc1ccccc1.O=c1c2ccccc2sc2ccccc12.
What is the InChIKey of aniline;thioxanthen-9-one?
The InChIKey is ANPQYXPQZDCHQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8OS.C6H7N/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;7-6-4-2-1-3-5-6/h1-8H;1-5H,7H2.
What are the key properties of aniline;thioxanthen-9-one?
aniline;thioxanthen-9-one has a molecular weight of 305.40 g/mol, XLogP of 4.68, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;thioxanthen-9-one is sourced from PubChem (CID 157172339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).