About 3-iododibenzothiophene
3-iododibenzothiophene (PubChem CID 86150547) has the molecular formula C12H7IS
and a molecular weight of 310.16 g/mol. Its IUPAC name is 3-iododibenzothiophene.
Molecular Properties
| Compound Name | 3-iododibenzothiophene |
| PubChem CID | 86150547 |
| Molecular Formula | C12H7IS |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 309.93 |
| IUPAC Name | 3-iododibenzothiophene |
| SMILES | Ic1ccc2c(c1)sc1ccccc12 |
| InChI | InChI=1S/C12H7IS/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h1-7H |
| InChIKey | AGNFBTRVRIGHAS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iododibenzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iododibenzothiophene?
The IUPAC name of 3-iododibenzothiophene (CID 86150547) is 3-iododibenzothiophene.
What is the SMILES notation for 3-iododibenzothiophene?
The canonical SMILES for 3-iododibenzothiophene is Ic1ccc2c(c1)sc1ccccc12.
What is the InChIKey of 3-iododibenzothiophene?
The InChIKey is AGNFBTRVRIGHAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7IS/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h1-7H.
What are the key properties of 3-iododibenzothiophene?
3-iododibenzothiophene has a molecular weight of 310.16 g/mol, XLogP of 4.66, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iododibenzothiophene is sourced from PubChem (CID 86150547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).