C24H32S — CID 142509932
dibenzothiophene;ethane;2-methylcyclohepta-1,3-diene (PubChem CID 142509932) has the molecular formula C24H32S and a molecular weight of 352.59 g/mol. Its IUPAC name is dibenzothiophene;ethane;2-methylcyclohepta-1,3-diene.
| Compound Name | dibenzothiophene;ethane;2-methylcyclohepta-1,3-diene |
|---|---|
| PubChem CID | 142509932 |
| Molecular Formula | C24H32S |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | dibenzothiophene;ethane;2-methylcyclohepta-1,3-diene |
| SMILES | CC.CC.CC1=CCCCC=C1.c1ccc2c(c1)sc1ccccc12 |
| InChI | InChI=1S/C12H8S.C8H12.2C2H6/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-8-6-4-2-3-5-7-8;2*1-2/h1-8H;4,6-7H,2-3,5H2,1H3;2*1-2H3 |
| InChIKey | ZACDBAATGWWMEQ-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |