C50H43NS — CID 142352880
ethane;2-methylcyclohexa-1,3-diene;[8-(4-phenylnaphthalen-1-yl)dibenzothiophen-1-yl]-(3-phenylphenyl)methanimine (PubChem CID 142352880) has the molecular formula C50H43NS and a molecular weight of 689.97 g/mol. Its IUPAC name is ethane;2-methylcyclohexa-1,3-diene;[8-(4-phenylnaphthalen-1-yl)dibenzothiophen-1-yl]-(3-phenylphenyl)methanimine.
| Compound Name | ethane;2-methylcyclohexa-1,3-diene;[8-(4-phenylnaphthalen-1-yl)dibenzothiophen-1-yl]-(3-phenylphenyl)methanimine |
|---|---|
| PubChem CID | 142352880 |
| Molecular Formula | C50H43NS |
| Molecular Weight | 689.97 g/mol |
| Exact Mass | 689.31 |
| IUPAC Name | ethane;2-methylcyclohexa-1,3-diene;[8-(4-phenylnaphthalen-1-yl)dibenzothiophen-1-yl]-(3-phenylphenyl)methanimine |
| SMILES | CC.CC1=CCCC=C1.[H]/N=C(\c1cccc(-c2ccccc2)c1)c1cccc2sc3ccc(-c4ccc(-c5ccccc5)c5ccccc45)cc3c12 |
| InChI | InChI=1S/C41H27NS.C7H10.C2H6/c42-41(31-16-9-15-29(25-31)27-11-3-1-4-12-27)36-19-10-20-39-40(36)37-26-30(21-24-38(37)43-39)33-23-22-32(28-13-5-2-6-14-28)34-17-7-8-18-35(33)34;1-7-5-3-2-4-6-7;1-2/h1-26,42H;3,5-6H,2,4H2,1H3;1-2H3/b42-41+;; |
| InChIKey | FQCYEPJQHWKUCL-NZWRDQTFSA-N |
| XLogP | 14.93 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.97 |
| LogP ≤ 5 | 14.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|