C25H17NS — CID 145447302
[8-(4-phenylphenyl)dibenzothiophen-1-yl]methanimine (PubChem CID 145447302) has the molecular formula C25H17NS and a molecular weight of 363.49 g/mol. Its IUPAC name is [8-(4-phenylphenyl)dibenzothiophen-1-yl]methanimine.
| Compound Name | [8-(4-phenylphenyl)dibenzothiophen-1-yl]methanimine |
|---|---|
| PubChem CID | 145447302 |
| Molecular Formula | C25H17NS |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | [8-(4-phenylphenyl)dibenzothiophen-1-yl]methanimine |
| SMILES | [H]/N=C/c1cccc2sc3ccc(-c4ccc(-c5ccccc5)cc4)cc3c12 |
| InChI | InChI=1S/C25H17NS/c26-16-21-7-4-8-24-25(21)22-15-20(13-14-23(22)27-24)19-11-9-18(10-12-19)17-5-2-1-3-6-17/h1-16,26H/b26-16+ |
| InChIKey | YCCTVKAKBDNCJV-WGOQTCKBSA-N |
| XLogP | 7.39 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|