C31H19NOS — CID 156643036
[8-(9-phenyldibenzothiophen-1-yl)dibenzofuran-1-yl]methanimine (PubChem CID 156643036) has the molecular formula C31H19NOS and a molecular weight of 453.57 g/mol. Its IUPAC name is [8-(9-phenyldibenzothiophen-1-yl)dibenzofuran-1-yl]methanimine.
| Compound Name | [8-(9-phenyldibenzothiophen-1-yl)dibenzofuran-1-yl]methanimine |
|---|---|
| PubChem CID | 156643036 |
| Molecular Formula | C31H19NOS |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | [8-(9-phenyldibenzothiophen-1-yl)dibenzofuran-1-yl]methanimine |
| SMILES | [H]/N=C/c1cccc2oc3ccc(-c4cccc5sc6cccc(-c7ccccc7)c6c45)cc3c12 |
| InChI | InChI=1S/C31H19NOS/c32-18-21-9-4-12-26-29(21)24-17-20(15-16-25(24)33-26)23-11-6-14-28-31(23)30-22(10-5-13-27(30)34-28)19-7-2-1-3-8-19/h1-18,32H/b32-18+ |
| InChIKey | MLVWIIQYDFLBGN-KCSSXMTESA-N |
| XLogP | 9.29 |
| TPSA | 36.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|