C33H21NO — CID 145447318
[8-(6-phenylphenanthren-2-yl)dibenzofuran-1-yl]methanimine (PubChem CID 145447318) has the molecular formula C33H21NO and a molecular weight of 447.54 g/mol. Its IUPAC name is [8-(6-phenylphenanthren-2-yl)dibenzofuran-1-yl]methanimine.
| Compound Name | [8-(6-phenylphenanthren-2-yl)dibenzofuran-1-yl]methanimine |
|---|---|
| PubChem CID | 145447318 |
| Molecular Formula | C33H21NO |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | [8-(6-phenylphenanthren-2-yl)dibenzofuran-1-yl]methanimine |
| SMILES | [H]/N=C/c1cccc2oc3ccc(-c4ccc5c(ccc6ccc(-c7ccccc7)cc65)c4)cc3c12 |
| InChI | InChI=1S/C33H21NO/c34-20-27-7-4-8-32-33(27)30-19-25(14-16-31(30)35-32)23-13-15-28-26(17-23)12-10-22-9-11-24(18-29(22)28)21-5-2-1-3-6-21/h1-20,34H/b34-20+ |
| InChIKey | ZANSNWMPMKNQEM-QXUDOOCXSA-N |
| XLogP | 9.22 |
| TPSA | 36.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|