C31H21NS — CID 142319431
(3-dibenzothiophen-1-ylphenyl)-(3-phenylphenyl)methanimine (PubChem CID 142319431) has the molecular formula C31H21NS and a molecular weight of 439.58 g/mol. Its IUPAC name is (3-dibenzothiophen-1-ylphenyl)-(3-phenylphenyl)methanimine.
| Compound Name | (3-dibenzothiophen-1-ylphenyl)-(3-phenylphenyl)methanimine |
|---|---|
| PubChem CID | 142319431 |
| Molecular Formula | C31H21NS |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | (3-dibenzothiophen-1-ylphenyl)-(3-phenylphenyl)methanimine |
| SMILES | [H]/N=C(\c1cccc(-c2ccccc2)c1)c1cccc(-c2cccc3sc4ccccc4c23)c1 |
| InChI | InChI=1S/C31H21NS/c32-31(24-13-6-11-22(19-24)21-9-2-1-3-10-21)25-14-7-12-23(20-25)26-16-8-18-29-30(26)27-15-4-5-17-28(27)33-29/h1-20,32H/b32-31+ |
| InChIKey | JNXPNADAQLKILV-QNEJGDQOSA-N |
| XLogP | 8.80 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|