C37H25NS — CID 145447392
[8-[2-phenyl-4-(3-phenylphenyl)phenyl]dibenzothiophen-1-yl]methanimine (PubChem CID 145447392) has the molecular formula C37H25NS and a molecular weight of 515.68 g/mol. Its IUPAC name is [8-[2-phenyl-4-(3-phenylphenyl)phenyl]dibenzothiophen-1-yl]methanimine.
| Compound Name | [8-[2-phenyl-4-(3-phenylphenyl)phenyl]dibenzothiophen-1-yl]methanimine |
|---|---|
| PubChem CID | 145447392 |
| Molecular Formula | C37H25NS |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | [8-[2-phenyl-4-(3-phenylphenyl)phenyl]dibenzothiophen-1-yl]methanimine |
| SMILES | [H]/N=C/c1cccc2sc3ccc(-c4ccc(-c5cccc(-c6ccccc6)c5)cc4-c4ccccc4)cc3c12 |
| InChI | InChI=1S/C37H25NS/c38-24-31-15-8-16-36-37(31)34-23-30(18-20-35(34)39-36)32-19-17-29(22-33(32)26-11-5-2-6-12-26)28-14-7-13-27(21-28)25-9-3-1-4-10-25/h1-24,38H/b38-24+ |
| InChIKey | NRRQIJSMJUNXQX-RQXXSLPSSA-N |
| XLogP | 10.72 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|