C53H38N2O4S — CID 145447712
(Z)-N'-methylidene-3-phenyl-1-(8-triphenylen-2-yldibenzothiophen-1-yl)prop-2-ene-1,3-diimine;5-(4-methylphenyl)benzene-1,2,3,4-tetrol (PubChem CID 145447712) has the molecular formula C53H38N2O4S and a molecular weight of 798.96 g/mol. Its IUPAC name is (Z)-N'-methylidene-3-phenyl-1-(8-triphenylen-2-yldibenzothiophen-1-yl)prop-2-ene-1,3-diimine;5-(4-methylphenyl)benzene-1,2,3,4-tetrol.
| Compound Name | (Z)-N'-methylidene-3-phenyl-1-(8-triphenylen-2-yldibenzothiophen-1-yl)prop-2-ene-1,3-diimine;5-(4-methylphenyl)benzene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 145447712 |
| Molecular Formula | C53H38N2O4S |
| Molecular Weight | 798.96 g/mol |
| Exact Mass | 798.26 |
| IUPAC Name | (Z)-N'-methylidene-3-phenyl-1-(8-triphenylen-2-yldibenzothiophen-1-yl)prop-2-ene-1,3-diimine;5-(4-methylphenyl)benzene-1,2,3,4-tetrol |
| SMILES | Cc1ccc(-c2cc(O)c(O)c(O)c2O)cc1.[H]/N=C(\C=C(/N=C)c1ccccc1)c1cccc2sc3ccc(-c4ccc5c6ccccc6c6ccccc6c5c4)cc3c12 |
| InChI | InChI=1S/C40H26N2S.C13H12O4/c1-42-37(25-10-3-2-4-11-25)24-36(41)33-16-9-17-39-40(33)35-23-27(19-21-38(35)43-39)26-18-20-32-30-14-6-5-12-28(30)29-13-7-8-15-31(29)34(32)22-26;1-7-2-4-8(5-3-7)9-6-10(14)12(16)13(17)11(9)15/h2-24,41H,1H2;2-6,14-17H,1H3/b37-24-,41-36+; |
| InChIKey | ZIQGJEIGKKVYDB-RBKUWZLGSA-N |
| XLogP | 13.78 |
| TPSA | 117.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.96 |
| LogP ≤ 5 | 13.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|