C46H30N2O — CID 145452578
(Z)-3-(10-dibenzofuran-3-yltriphenylen-1-yl)-N'-methylidene-1-(4-phenylphenyl)prop-2-ene-1,3-diimine (PubChem CID 145452578) has the molecular formula C46H30N2O and a molecular weight of 626.76 g/mol. Its IUPAC name is (Z)-3-(10-dibenzofuran-3-yltriphenylen-1-yl)-N'-methylidene-1-(4-phenylphenyl)prop-2-ene-1,3-diimine.
| Compound Name | (Z)-3-(10-dibenzofuran-3-yltriphenylen-1-yl)-N'-methylidene-1-(4-phenylphenyl)prop-2-ene-1,3-diimine |
|---|---|
| PubChem CID | 145452578 |
| Molecular Formula | C46H30N2O |
| Molecular Weight | 626.76 g/mol |
| Exact Mass | 626.24 |
| IUPAC Name | (Z)-3-(10-dibenzofuran-3-yltriphenylen-1-yl)-N'-methylidene-1-(4-phenylphenyl)prop-2-ene-1,3-diimine |
| SMILES | [H]/N=C(/C=C(\N=C)c1cccc2c3ccccc3c3cc(-c4ccc5c(c4)oc4ccccc45)ccc3c12)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C46H30N2O/c1-48-43(28-42(47)31-20-18-30(19-21-31)29-10-3-2-4-11-29)40-16-9-15-38-34-12-5-6-13-35(34)41-26-32(23-25-39(41)46(38)40)33-22-24-37-36-14-7-8-17-44(36)49-45(37)27-33/h2-28,47H,1H2/b43-28-,47-42- |
| InChIKey | GUUQXTRKSDBLGI-ISBJDNTESA-N |
| XLogP | 12.49 |
| TPSA | 49.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.76 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|