C45H32N2O — CID 145447951
(Z)-3-imino-1-phenyl-3-[8-[2-phenyl-4-(4-phenylphenyl)phenyl]dibenzofuran-1-yl]prop-1-en-1-amine (PubChem CID 145447951) has the molecular formula C45H32N2O and a molecular weight of 616.76 g/mol. Its IUPAC name is (Z)-3-imino-1-phenyl-3-[8-[2-phenyl-4-(4-phenylphenyl)phenyl]dibenzofuran-1-yl]prop-1-en-1-amine.
| Compound Name | (Z)-3-imino-1-phenyl-3-[8-[2-phenyl-4-(4-phenylphenyl)phenyl]dibenzofuran-1-yl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 145447951 |
| Molecular Formula | C45H32N2O |
| Molecular Weight | 616.76 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | (Z)-3-imino-1-phenyl-3-[8-[2-phenyl-4-(4-phenylphenyl)phenyl]dibenzofuran-1-yl]prop-1-en-1-amine |
| SMILES | [H]/N=C(\C=C(/N)c1ccccc1)c1cccc2oc3ccc(-c4ccc(-c5ccc(-c6ccccc6)cc5)cc4-c4ccccc4)cc3c12 |
| InChI | InChI=1S/C45H32N2O/c46-41(34-15-8-3-9-16-34)29-42(47)38-17-10-18-44-45(38)40-28-36(24-26-43(40)48-44)37-25-23-35(27-39(37)33-13-6-2-7-14-33)32-21-19-31(20-22-32)30-11-4-1-5-12-30/h1-29,47H,46H2/b41-29-,47-42+ |
| InChIKey | DAHBJJMETPLNIX-UTIOMGJJSA-N |
| XLogP | 11.62 |
| TPSA | 63.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.76 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|