C62H50N4O2 — CID 143904949
(Z)-3-imino-1,3-diphenylprop-1-en-1-amine;N-[(Z)-3-imino-1,3-diphenylprop-1-enyl]-3-[4-methoxy-3-[8-(3-methylphenyl)dibenzofuran-3-yl]phenyl]aniline (PubChem CID 143904949) has the molecular formula C62H50N4O2 and a molecular weight of 883.11 g/mol. Its IUPAC name is (Z)-3-imino-1,3-diphenylprop-1-en-1-amine;N-[(Z)-3-imino-1,3-diphenylprop-1-enyl]-3-[4-methoxy-3-[8-(3-methylphenyl)dibenzofuran-3-yl]phenyl]aniline.
| Compound Name | (Z)-3-imino-1,3-diphenylprop-1-en-1-amine;N-[(Z)-3-imino-1,3-diphenylprop-1-enyl]-3-[4-methoxy-3-[8-(3-methylphenyl)dibenzofuran-3-yl]phenyl]aniline |
|---|---|
| PubChem CID | 143904949 |
| Molecular Formula | C62H50N4O2 |
| Molecular Weight | 883.11 g/mol |
| Exact Mass | 882.39 |
| IUPAC Name | (Z)-3-imino-1,3-diphenylprop-1-en-1-amine;N-[(Z)-3-imino-1,3-diphenylprop-1-enyl]-3-[4-methoxy-3-[8-(3-methylphenyl)dibenzofuran-3-yl]phenyl]aniline |
| SMILES | [H]/N=C(/C=C(\N)c1ccccc1)c1ccccc1.[H]/N=C(/C=C(\Nc1cccc(-c2ccc(OC)c(-c3ccc4c(c3)oc3ccc(-c5cccc(C)c5)cc34)c2)c1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C47H36N2O2.C15H14N2/c1-31-11-9-16-34(25-31)37-21-24-46-42(28-37)40-22-19-38(29-47(40)51-46)41-27-36(20-23-45(41)50-2)35-17-10-18-39(26-35)49-44(33-14-7-4-8-15-33)30-43(48)32-12-5-3-6-13-32;16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h3-30,48-49H,1-2H3;1-11,16H,17H2/b44-30-,48-43-;15-11-,16-14- |
| InChIKey | KDWGAFQJFZMKFO-RDIKKQIISA-N |
| XLogP | 15.48 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.11 |
| LogP ≤ 5 | 15.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|