C65H49N3 — CID 145334582
(Z)-3-imino-1-(4-phenylphenyl)-3-[3-[3-(10-phenylspiro[acridine-9,9'-fluorene]-3'-yl)phenyl]phenyl]prop-1-en-1-amine;toluene (PubChem CID 145334582) has the molecular formula C65H49N3 and a molecular weight of 872.13 g/mol. Its IUPAC name is (Z)-3-imino-1-(4-phenylphenyl)-3-[3-[3-(10-phenylspiro[acridine-9,9'-fluorene]-3'-yl)phenyl]phenyl]prop-1-en-1-amine;toluene.
| Compound Name | (Z)-3-imino-1-(4-phenylphenyl)-3-[3-[3-(10-phenylspiro[acridine-9,9'-fluorene]-3'-yl)phenyl]phenyl]prop-1-en-1-amine;toluene |
|---|---|
| PubChem CID | 145334582 |
| Molecular Formula | C65H49N3 |
| Molecular Weight | 872.13 g/mol |
| Exact Mass | 871.39 |
| IUPAC Name | (Z)-3-imino-1-(4-phenylphenyl)-3-[3-[3-(10-phenylspiro[acridine-9,9'-fluorene]-3'-yl)phenyl]phenyl]prop-1-en-1-amine;toluene |
| SMILES | Cc1ccccc1.[H]/N=C(\C=C(/N)c1ccc(-c2ccccc2)cc1)c1cccc(-c2cccc(-c3ccc4c(c3)-c3ccccc3C43c4ccccc4N(c4ccccc4)c4ccccc43)c2)c1 |
| InChI | InChI=1S/C58H41N3.C7H8/c59-54(41-31-29-40(30-32-41)39-15-3-1-4-16-39)38-55(60)46-20-14-19-44(36-46)42-17-13-18-43(35-42)45-33-34-51-49(37-45)48-23-7-8-24-50(48)58(51)52-25-9-11-27-56(52)61(47-21-5-2-6-22-47)57-28-12-10-26-53(57)58;1-7-5-3-2-4-6-7/h1-38,60H,59H2;2-6H,1H3/b54-38-,60-55+; |
| InChIKey | XHGIFUPTKUMEFN-LQQCODRUSA-N |
| XLogP | 16.20 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.13 |
| LogP ≤ 5 | 16.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|