C22H20N2 — CID 145412713
(Z)-3-imino-1-[4-(3-methylphenyl)phenyl]-3-phenylprop-1-en-1-amine (PubChem CID 145412713) has the molecular formula C22H20N2 and a molecular weight of 312.42 g/mol. Its IUPAC name is (Z)-3-imino-1-[4-(3-methylphenyl)phenyl]-3-phenylprop-1-en-1-amine.
| Compound Name | (Z)-3-imino-1-[4-(3-methylphenyl)phenyl]-3-phenylprop-1-en-1-amine |
|---|---|
| PubChem CID | 145412713 |
| Molecular Formula | C22H20N2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (Z)-3-imino-1-[4-(3-methylphenyl)phenyl]-3-phenylprop-1-en-1-amine |
| SMILES | [H]/N=C(/C=C(\N)c1ccc(-c2cccc(C)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H20N2/c1-16-6-5-9-20(14-16)17-10-12-19(13-11-17)22(24)15-21(23)18-7-3-2-4-8-18/h2-15,23H,24H2,1H3/b22-15-,23-21- |
| InChIKey | UOSQUMICUMIPFD-VEKUZUDLSA-N |
| XLogP | 5.03 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|