C47H34N2S — CID 142293873
benzene;(Z)-3-imino-3-phenyl-1-[3-[3-(21-thiapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8,10,12,15(20),16,18-decaen-19-yl)phenyl]phenyl]prop-1-en-1-amine (PubChem CID 142293873) has the molecular formula C47H34N2S and a molecular weight of 658.87 g/mol. Its IUPAC name is benzene;(Z)-3-imino-3-phenyl-1-[3-[3-(21-thiapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8,10,12,15(20),16,18-decaen-19-yl)phenyl]phenyl]prop-1-en-1-amine.
| Compound Name | benzene;(Z)-3-imino-3-phenyl-1-[3-[3-(21-thiapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8,10,12,15(20),16,18-decaen-19-yl)phenyl]phenyl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 142293873 |
| Molecular Formula | C47H34N2S |
| Molecular Weight | 658.87 g/mol |
| Exact Mass | 658.24 |
| IUPAC Name | benzene;(Z)-3-imino-3-phenyl-1-[3-[3-(21-thiapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8,10,12,15(20),16,18-decaen-19-yl)phenyl]phenyl]prop-1-en-1-amine |
| SMILES | [H]/N=C(/C=C(\N)c1cccc(-c2cccc(-c3cccc4c3sc3c5ccccc5c5ccccc5c43)c2)c1)c1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C41H28N2S.C6H6/c42-37(26-11-2-1-3-12-26)25-38(43)30-16-9-14-28(24-30)27-13-8-15-29(23-27)31-21-10-22-36-39-34-19-6-4-17-32(34)33-18-5-7-20-35(33)41(39)44-40(31)36;1-2-4-6-5-3-1/h1-25,42H,43H2;1-6H/b38-25-,42-37-; |
| InChIKey | XKSPLTDIPWSHIV-YMZKQVHOSA-N |
| XLogP | 12.75 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.87 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|