C54H43N — CID 144803315
ethane;(Z)-3-[3-[3-(10-methyltriphenylen-2-yl)-5-phenylphenyl]phenyl]-1,3-diphenylprop-2-en-1-imine (PubChem CID 144803315) has the molecular formula C54H43N and a molecular weight of 705.95 g/mol. Its IUPAC name is ethane;(Z)-3-[3-[3-(10-methyltriphenylen-2-yl)-5-phenylphenyl]phenyl]-1,3-diphenylprop-2-en-1-imine.
| Compound Name | ethane;(Z)-3-[3-[3-(10-methyltriphenylen-2-yl)-5-phenylphenyl]phenyl]-1,3-diphenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 144803315 |
| Molecular Formula | C54H43N |
| Molecular Weight | 705.95 g/mol |
| Exact Mass | 705.34 |
| IUPAC Name | ethane;(Z)-3-[3-[3-(10-methyltriphenylen-2-yl)-5-phenylphenyl]phenyl]-1,3-diphenylprop-2-en-1-imine |
| SMILES | CC.[H]/N=C(/C=C(/c1ccccc1)c1cccc(-c2cc(-c3ccccc3)cc(-c3ccc4c5ccccc5c5cc(C)ccc5c4c3)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C52H37N.C2H6/c1-35-24-26-48-50(28-35)46-23-12-11-22-45(46)47-27-25-40(33-51(47)48)44-31-42(36-14-5-2-6-15-36)30-43(32-44)39-20-13-21-41(29-39)49(37-16-7-3-8-17-37)34-52(53)38-18-9-4-10-19-38;1-2/h2-34,53H,1H3;1-2H3/b49-34-,53-52-; |
| InChIKey | RFIFCLFLCSIMBC-CFUHOKHBSA-N |
| XLogP | 14.98 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.95 |
| LogP ≤ 5 | 14.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|