C52H36N4 — CID 166569065
(Z)-1,3-diphenyl-3-[7-[3-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]naphthalen-1-yl]prop-2-en-1-imine (PubChem CID 166569065) has the molecular formula C52H36N4 and a molecular weight of 716.89 g/mol. Its IUPAC name is (Z)-1,3-diphenyl-3-[7-[3-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]naphthalen-1-yl]prop-2-en-1-imine.
| Compound Name | (Z)-1,3-diphenyl-3-[7-[3-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]naphthalen-1-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 166569065 |
| Molecular Formula | C52H36N4 |
| Molecular Weight | 716.89 g/mol |
| Exact Mass | 716.29 |
| IUPAC Name | (Z)-1,3-diphenyl-3-[7-[3-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]naphthalen-1-yl]prop-2-en-1-imine |
| SMILES | [H]/N=C(/C=C(/c1ccccc1)c1cccc2ccc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5cccc(-c6ccccc6)c5)n4)c3)cc12)c1ccccc1 |
| InChI | InChI=1S/C52H36N4/c53-49(39-20-9-3-10-21-39)35-48(37-18-7-2-8-19-37)46-29-15-24-38-30-31-43(34-47(38)46)42-26-14-28-45(33-42)52-55-50(40-22-11-4-12-23-40)54-51(56-52)44-27-13-25-41(32-44)36-16-5-1-6-17-36/h1-35,53H/b48-35-,53-49- |
| InChIKey | KNYZFHCWSPBZLL-JGKNMGDHSA-N |
| XLogP | 12.86 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.89 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|