C49H33NS — CID 142294158
(E)-1-[3-(3-naphtho[2,3-b][1]benzothiol-3-ylphenyl)phenyl]-3-phenyl-3-(4-phenylphenyl)prop-2-en-1-imine (PubChem CID 142294158) has the molecular formula C49H33NS and a molecular weight of 667.88 g/mol. Its IUPAC name is (E)-1-[3-(3-naphtho[2,3-b][1]benzothiol-3-ylphenyl)phenyl]-3-phenyl-3-(4-phenylphenyl)prop-2-en-1-imine.
| Compound Name | (E)-1-[3-(3-naphtho[2,3-b][1]benzothiol-3-ylphenyl)phenyl]-3-phenyl-3-(4-phenylphenyl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 142294158 |
| Molecular Formula | C49H33NS |
| Molecular Weight | 667.88 g/mol |
| Exact Mass | 667.23 |
| IUPAC Name | (E)-1-[3-(3-naphtho[2,3-b][1]benzothiol-3-ylphenyl)phenyl]-3-phenyl-3-(4-phenylphenyl)prop-2-en-1-imine |
| SMILES | [H]/N=C(/C=C(\c1ccccc1)c1ccc(-c2ccccc2)cc1)c1cccc(-c2cccc(-c3ccc4c(c3)sc3cc5ccccc5cc34)c2)c1 |
| InChI | InChI=1S/C49H33NS/c50-47(32-45(35-13-5-2-6-14-35)36-23-21-34(22-24-36)33-11-3-1-4-12-33)43-20-10-19-39(28-43)37-17-9-18-38(27-37)42-25-26-44-46-29-40-15-7-8-16-41(40)30-49(46)51-48(44)31-42/h1-32,50H/b45-32+,50-47- |
| InChIKey | GHAJHHRYKSDYKU-ZJYLOMTGSA-N |
| XLogP | 13.71 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.88 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|