C59H41N3 — CID 166568910
(Z)-3-[7-[4-[4,6-bis(4-phenylphenyl)pyrimidin-2-yl]phenyl]naphthalen-1-yl]-1,3-diphenylprop-2-en-1-imine (PubChem CID 166568910) has the molecular formula C59H41N3 and a molecular weight of 792.00 g/mol. Its IUPAC name is (Z)-3-[7-[4-[4,6-bis(4-phenylphenyl)pyrimidin-2-yl]phenyl]naphthalen-1-yl]-1,3-diphenylprop-2-en-1-imine.
| Compound Name | (Z)-3-[7-[4-[4,6-bis(4-phenylphenyl)pyrimidin-2-yl]phenyl]naphthalen-1-yl]-1,3-diphenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 166568910 |
| Molecular Formula | C59H41N3 |
| Molecular Weight | 792.00 g/mol |
| Exact Mass | 791.33 |
| IUPAC Name | (Z)-3-[7-[4-[4,6-bis(4-phenylphenyl)pyrimidin-2-yl]phenyl]naphthalen-1-yl]-1,3-diphenylprop-2-en-1-imine |
| SMILES | [H]/N=C(/C=C(/c1ccccc1)c1cccc2ccc(-c3ccc(-c4nc(-c5ccc(-c6ccccc6)cc5)cc(-c5ccc(-c6ccccc6)cc5)n4)cc3)cc12)c1ccccc1 |
| InChI | InChI=1S/C59H41N3/c60-56(48-20-11-4-12-21-48)39-55(46-18-9-3-10-19-46)53-23-13-22-47-30-37-52(38-54(47)53)45-28-35-51(36-29-45)59-61-57(49-31-24-43(25-32-49)41-14-5-1-6-15-41)40-58(62-59)50-33-26-44(27-34-50)42-16-7-2-8-17-42/h1-40,60H/b55-39-,60-56- |
| InChIKey | ODGNAYOGATZRBP-BUMWAXHASA-N |
| XLogP | 15.13 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.00 |
| LogP ≤ 5 | 15.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|