C49H36N2 — CID 166796424
4-[4-[(3Z)-4-(2-methylnaphthalen-1-yl)-4-phenylbuta-1,3-dien-2-yl]phenyl]-2-phenyl-6-(4-phenylphenyl)pyrimidine (PubChem CID 166796424) has the molecular formula C49H36N2 and a molecular weight of 652.84 g/mol. Its IUPAC name is 4-[4-[(3Z)-4-(2-methylnaphthalen-1-yl)-4-phenylbuta-1,3-dien-2-yl]phenyl]-2-phenyl-6-(4-phenylphenyl)pyrimidine.
| Compound Name | 4-[4-[(3Z)-4-(2-methylnaphthalen-1-yl)-4-phenylbuta-1,3-dien-2-yl]phenyl]-2-phenyl-6-(4-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 166796424 |
| Molecular Formula | C49H36N2 |
| Molecular Weight | 652.84 g/mol |
| Exact Mass | 652.29 |
| IUPAC Name | 4-[4-[(3Z)-4-(2-methylnaphthalen-1-yl)-4-phenylbuta-1,3-dien-2-yl]phenyl]-2-phenyl-6-(4-phenylphenyl)pyrimidine |
| SMILES | C=C(/C=C(/c1ccccc1)c1c(C)ccc2ccccc12)c1ccc(-c2cc(-c3ccc(-c4ccccc4)cc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C49H36N2/c1-34-22-23-40-18-12-13-21-44(40)48(34)45(39-16-8-4-9-17-39)32-35(2)36-24-28-41(29-25-36)46-33-47(51-49(50-46)43-19-10-5-11-20-43)42-30-26-38(27-31-42)37-14-6-3-7-15-37/h3-33H,2H2,1H3/b45-32- |
| InChIKey | WSKCELJFBFKBBC-CCKYQJAJSA-N |
| XLogP | 12.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.84 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|