C23H18N2 — CID 154033384
3-imino-1,3-dinaphthalen-2-ylprop-1-en-1-amine (PubChem CID 154033384) has the molecular formula C23H18N2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 3-imino-1,3-dinaphthalen-2-ylprop-1-en-1-amine.
| Compound Name | 3-imino-1,3-dinaphthalen-2-ylprop-1-en-1-amine |
|---|---|
| PubChem CID | 154033384 |
| Molecular Formula | C23H18N2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 3-imino-1,3-dinaphthalen-2-ylprop-1-en-1-amine |
| SMILES | [H]/N=C(/C=C(N)c1ccc2ccccc2c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H18N2/c24-22(20-11-9-16-5-1-3-7-18(16)13-20)15-23(25)21-12-10-17-6-2-4-8-19(17)14-21/h1-15,24H,25H2/b23-15?,24-22- |
| InChIKey | VVJAVQXUTDLHGQ-KAVBBYSRSA-N |
| XLogP | 5.36 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|