C64H49N3 — CID 145077194
(Z)-3-imino-1,3-diphenylprop-1-en-1-amine;6-(3-methylphenyl)-1,2,3,4,9-pentakis-phenylcarbazole (PubChem CID 145077194) has the molecular formula C64H49N3 and a molecular weight of 860.12 g/mol. Its IUPAC name is (Z)-3-imino-1,3-diphenylprop-1-en-1-amine;6-(3-methylphenyl)-1,2,3,4,9-pentakis-phenylcarbazole.
| Compound Name | (Z)-3-imino-1,3-diphenylprop-1-en-1-amine;6-(3-methylphenyl)-1,2,3,4,9-pentakis-phenylcarbazole |
|---|---|
| PubChem CID | 145077194 |
| Molecular Formula | C64H49N3 |
| Molecular Weight | 860.12 g/mol |
| Exact Mass | 859.39 |
| IUPAC Name | (Z)-3-imino-1,3-diphenylprop-1-en-1-amine;6-(3-methylphenyl)-1,2,3,4,9-pentakis-phenylcarbazole |
| SMILES | Cc1cccc(-c2ccc3c(c2)c2c(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)c2n3-c2ccccc2)c1.[H]/N=C(/C=C(\N)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C49H35N.C15H14N2/c1-34-18-17-27-39(32-34)40-30-31-43-42(33-40)48-46(37-23-11-4-12-24-37)44(35-19-7-2-8-20-35)45(36-21-9-3-10-22-36)47(38-25-13-5-14-26-38)49(48)50(43)41-28-15-6-16-29-41;16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h2-33H,1H3;1-11,16H,17H2/b;15-11-,16-14- |
| InChIKey | AFGDMOCZQRDDIG-YUDJFVQHSA-N |
| XLogP | 16.48 |
| TPSA | 54.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.12 |
| LogP ≤ 5 | 16.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|