C44H32N2 — CID 144756301
[5-(9,10-diphenylanthracen-2-yl)-2-ethenyl-1-(3-methylphenyl)indol-3-yl]methanimine (PubChem CID 144756301) has the molecular formula C44H32N2 and a molecular weight of 588.75 g/mol. Its IUPAC name is [5-(9,10-diphenylanthracen-2-yl)-2-ethenyl-1-(3-methylphenyl)indol-3-yl]methanimine.
| Compound Name | [5-(9,10-diphenylanthracen-2-yl)-2-ethenyl-1-(3-methylphenyl)indol-3-yl]methanimine |
|---|---|
| PubChem CID | 144756301 |
| Molecular Formula | C44H32N2 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | [5-(9,10-diphenylanthracen-2-yl)-2-ethenyl-1-(3-methylphenyl)indol-3-yl]methanimine |
| SMILES | [H]/N=C/c1c(C=C)n(-c2cccc(C)c2)c2ccc(-c3ccc4c(-c5ccccc5)c5ccccc5c(-c5ccccc5)c4c3)cc12 |
| InChI | InChI=1S/C44H32N2/c1-3-41-40(28-45)38-26-33(22-24-42(38)46(41)34-18-12-13-29(2)25-34)32-21-23-37-39(27-32)44(31-16-8-5-9-17-31)36-20-11-10-19-35(36)43(37)30-14-6-4-7-15-30/h3-28,45H,1H2,2H3/b45-28+ |
| InChIKey | ZYGKAQQDVNLRMV-DYNJLWMLSA-N |
| XLogP | 11.89 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|