C49H34N2 — CID 129084260
[5-(9,10-diphenylanthracen-2-yl)-2-ethenyl-1-(4-phenylphenyl)indol-3-yl]methanimine (PubChem CID 129084260) has the molecular formula C49H34N2 and a molecular weight of 650.83 g/mol. Its IUPAC name is [5-(9,10-diphenylanthracen-2-yl)-2-ethenyl-1-(4-phenylphenyl)indol-3-yl]methanimine.
| Compound Name | [5-(9,10-diphenylanthracen-2-yl)-2-ethenyl-1-(4-phenylphenyl)indol-3-yl]methanimine |
|---|---|
| PubChem CID | 129084260 |
| Molecular Formula | C49H34N2 |
| Molecular Weight | 650.83 g/mol |
| Exact Mass | 650.27 |
| IUPAC Name | [5-(9,10-diphenylanthracen-2-yl)-2-ethenyl-1-(4-phenylphenyl)indol-3-yl]methanimine |
| SMILES | [H]/N=C/c1c(C=C)n(-c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccc4c(-c5ccccc5)c5ccccc5c(-c5ccccc5)c4c3)cc12 |
| InChI | InChI=1S/C49H34N2/c1-2-46-45(32-50)43-30-38(25-29-47(43)51(46)39-26-22-34(23-27-39)33-14-6-3-7-15-33)37-24-28-42-44(31-37)49(36-18-10-5-11-19-36)41-21-13-12-20-40(41)48(42)35-16-8-4-9-17-35/h2-32,50H,1H2/b50-32+ |
| InChIKey | MQAYJPFDVSCVBZ-SPZKPGDRSA-N |
| XLogP | 13.25 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.83 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|