C66H54N2 — CID 143933879
ethane;3-[6-[2-ethenyl-1-phenyl-3-[(Z)-prop-1-enyl]indol-5-yl]-9,10-diphenylanthracen-2-yl]-9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazole (PubChem CID 143933879) has the molecular formula C66H54N2 and a molecular weight of 875.17 g/mol. Its IUPAC name is ethane;3-[6-[2-ethenyl-1-phenyl-3-[(Z)-prop-1-enyl]indol-5-yl]-9,10-diphenylanthracen-2-yl]-9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazole.
| Compound Name | ethane;3-[6-[2-ethenyl-1-phenyl-3-[(Z)-prop-1-enyl]indol-5-yl]-9,10-diphenylanthracen-2-yl]-9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazole |
|---|---|
| PubChem CID | 143933879 |
| Molecular Formula | C66H54N2 |
| Molecular Weight | 875.17 g/mol |
| Exact Mass | 874.43 |
| IUPAC Name | ethane;3-[6-[2-ethenyl-1-phenyl-3-[(Z)-prop-1-enyl]indol-5-yl]-9,10-diphenylanthracen-2-yl]-9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]carbazole |
| SMILES | C=C/C=C(\C=C/C)n1c2ccccc2c2cc(-c3ccc4c(-c5ccccc5)c5cc(-c6ccc7c(c6)c(/C=C\C)c(C=C)n7-c6ccccc6)ccc5c(-c5ccccc5)c4c3)ccc21.CC |
| InChI | InChI=1S/C64H48N2.C2H6/c1-5-20-49(21-6-2)66-60-30-19-18-29-52(60)56-40-48(34-38-62(56)66)46-32-36-54-58(42-46)64(44-25-14-10-15-26-44)53-35-31-45(41-57(53)63(54)43-23-12-9-13-24-43)47-33-37-61-55(39-47)51(22-7-3)59(8-4)65(61)50-27-16-11-17-28-50;1-2/h5-42H,1,4H2,2-3H3;1-2H3/b21-6-,22-7-,49-20+; |
| InChIKey | ARDDSLYZZOMZSS-QWKPVHPSSA-N |
| XLogP | 19.02 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.17 |
| LogP ≤ 5 | 19.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|