C45H40N2 — CID 177063270
ethane;3-[2-ethenyl-1-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-3-[(Z)-prop-1-enyl]indol-5-yl]-9-phenylcarbazole (PubChem CID 177063270) has the molecular formula C45H40N2 and a molecular weight of 608.83 g/mol. Its IUPAC name is ethane;3-[2-ethenyl-1-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-3-[(Z)-prop-1-enyl]indol-5-yl]-9-phenylcarbazole.
| Compound Name | ethane;3-[2-ethenyl-1-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-3-[(Z)-prop-1-enyl]indol-5-yl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 177063270 |
| Molecular Formula | C45H40N2 |
| Molecular Weight | 608.83 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | ethane;3-[2-ethenyl-1-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-3-[(Z)-prop-1-enyl]indol-5-yl]-9-phenylcarbazole |
| SMILES | C=C/C=C(\C=C)c1ccc(-n2c(C=C)c(/C=C\C)c3cc(-c4ccc5c(c4)c4ccccc4n5-c4ccccc4)ccc32)cc1.CC |
| InChI | InChI=1S/C43H34N2.C2H6/c1-5-14-30(7-3)31-20-24-35(25-21-31)44-40(8-4)36(15-6-2)38-28-32(22-26-42(38)44)33-23-27-43-39(29-33)37-18-12-13-19-41(37)45(43)34-16-10-9-11-17-34;1-2/h5-29H,1,3-4H2,2H3;1-2H3/b15-6-,30-14+; |
| InChIKey | ZRUDQUHWKSOHJR-QYEROXDCSA-N |
| XLogP | 12.85 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.83 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|