C19H18BNO2 — CID 167453480
[4-[2-ethenyl-3-[(Z)-prop-1-enyl]indol-1-yl]phenyl]boronic acid (PubChem CID 167453480) has the molecular formula C19H18BNO2 and a molecular weight of 303.17 g/mol. Its IUPAC name is [4-[2-ethenyl-3-[(Z)-prop-1-enyl]indol-1-yl]phenyl]boronic acid.
| Compound Name | [4-[2-ethenyl-3-[(Z)-prop-1-enyl]indol-1-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 167453480 |
| Molecular Formula | C19H18BNO2 |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | [4-[2-ethenyl-3-[(Z)-prop-1-enyl]indol-1-yl]phenyl]boronic acid |
| SMILES | C=Cc1c(/C=C\C)c2ccccc2n1-c1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C19H18BNO2/c1-3-7-16-17-8-5-6-9-19(17)21(18(16)4-2)15-12-10-14(11-13-15)20(22)23/h3-13,22-23H,2H2,1H3/b7-3- |
| InChIKey | RNGIZIYNZKLIDI-CLTKARDFSA-N |
| XLogP | 2.99 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|