C26H20N2 — CID 144604962
3-[4-[2-ethenyl-3-[(Z)-prop-1-enyl]indol-1-yl]phenyl]benzonitrile (PubChem CID 144604962) has the molecular formula C26H20N2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 3-[4-[2-ethenyl-3-[(Z)-prop-1-enyl]indol-1-yl]phenyl]benzonitrile.
| Compound Name | 3-[4-[2-ethenyl-3-[(Z)-prop-1-enyl]indol-1-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 144604962 |
| Molecular Formula | C26H20N2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 3-[4-[2-ethenyl-3-[(Z)-prop-1-enyl]indol-1-yl]phenyl]benzonitrile |
| SMILES | C=Cc1c(/C=C\C)c2ccccc2n1-c1ccc(-c2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C26H20N2/c1-3-8-23-24-11-5-6-12-26(24)28(25(23)4-2)22-15-13-20(14-16-22)21-10-7-9-19(17-21)18-27/h3-17H,2H2,1H3/b8-3- |
| InChIKey | XNGOPNAIGCLVRZ-BAQGIRSFSA-N |
| XLogP | 6.85 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |