C19H17N — CID 91187792
2,3-bis(ethenyl)-1-(4-methylphenyl)indole (PubChem CID 91187792) has the molecular formula C19H17N and a molecular weight of 259.35 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1-(4-methylphenyl)indole.
| Compound Name | 2,3-bis(ethenyl)-1-(4-methylphenyl)indole |
|---|---|
| PubChem CID | 91187792 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2,3-bis(ethenyl)-1-(4-methylphenyl)indole |
| SMILES | C=Cc1c(C=C)n(-c2ccc(C)cc2)c2ccccc12 |
| InChI | InChI=1S/C19H17N/c1-4-16-17-8-6-7-9-19(17)20(18(16)5-2)15-12-10-14(3)11-13-15/h4-13H,1-2H2,3H3 |
| InChIKey | CEHZHFWIBBRJFI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |