C33H32N2 — CID 143599075
N-[4-[2,3-bis(ethenyl)indol-1-yl]phenyl]-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-propan-2-ylaniline (PubChem CID 143599075) has the molecular formula C33H32N2 and a molecular weight of 456.63 g/mol. Its IUPAC name is N-[4-[2,3-bis(ethenyl)indol-1-yl]phenyl]-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-propan-2-ylaniline.
| Compound Name | N-[4-[2,3-bis(ethenyl)indol-1-yl]phenyl]-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-propan-2-ylaniline |
|---|---|
| PubChem CID | 143599075 |
| Molecular Formula | C33H32N2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | N-[4-[2,3-bis(ethenyl)indol-1-yl]phenyl]-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-propan-2-ylaniline |
| SMILES | C=C/C=C(\C=C)N(c1ccc(C(C)C)cc1)c1ccc(-n2c(C=C)c(C=C)c3ccccc32)cc1 |
| InChI | InChI=1S/C33H32N2/c1-7-13-26(8-2)34(27-18-16-25(17-19-27)24(5)6)28-20-22-29(23-21-28)35-32(10-4)30(9-3)31-14-11-12-15-33(31)35/h7-24H,1-4H2,5-6H3/b26-13+ |
| InChIKey | CLNAFNIJGBTWLL-LGJNPRDNSA-N |
| XLogP | 9.43 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|