C38H34N2 — CID 166937509
N-[4-[4-(N-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylanilino)phenyl]phenyl]-4-methyl-N-phenylaniline (PubChem CID 166937509) has the molecular formula C38H34N2 and a molecular weight of 518.70 g/mol. Its IUPAC name is N-[4-[4-(N-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylanilino)phenyl]phenyl]-4-methyl-N-phenylaniline.
| Compound Name | N-[4-[4-(N-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylanilino)phenyl]phenyl]-4-methyl-N-phenylaniline |
|---|---|
| PubChem CID | 166937509 |
| Molecular Formula | C38H34N2 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | N-[4-[4-(N-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylanilino)phenyl]phenyl]-4-methyl-N-phenylaniline |
| SMILES | C=C/C=C(\C=C)N(c1ccc(C)cc1)c1ccc(-c2ccc(N(c3ccccc3)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H34N2/c1-5-10-33(6-2)39(35-21-13-29(3)14-22-35)37-25-17-31(18-26-37)32-19-27-38(28-20-32)40(34-11-8-7-9-12-34)36-23-15-30(4)16-24-36/h5-28H,1-2H2,3-4H3/b33-10+ |
| InChIKey | FFORHDMWYLBRNA-AOJZPQQRSA-N |
| XLogP | 10.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|