C24H20BrN — CID 145273368
4-(4-bromophenyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]-N-phenylaniline (PubChem CID 145273368) has the molecular formula C24H20BrN and a molecular weight of 402.34 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]-N-phenylaniline.
| Compound Name | 4-(4-bromophenyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]-N-phenylaniline |
|---|---|
| PubChem CID | 145273368 |
| Molecular Formula | C24H20BrN |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 4-(4-bromophenyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]-N-phenylaniline |
| SMILES | C=C/C=C(\C=C)N(c1ccccc1)c1ccc(-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C24H20BrN/c1-3-8-22(4-2)26(23-9-6-5-7-10-23)24-17-13-20(14-18-24)19-11-15-21(25)16-12-19/h3-18H,1-2H2/b22-8+ |
| InChIKey | VYXIZIHQSTZOQA-GZIVZEMBSA-N |
| XLogP | 7.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|