C20H20BrN — CID 144788159
N-(4-bromophenyl)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-methylaniline (PubChem CID 144788159) has the molecular formula C20H20BrN and a molecular weight of 354.29 g/mol. Its IUPAC name is N-(4-bromophenyl)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-methylaniline.
| Compound Name | N-(4-bromophenyl)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-methylaniline |
|---|---|
| PubChem CID | 144788159 |
| Molecular Formula | C20H20BrN |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | N-(4-bromophenyl)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-methylaniline |
| SMILES | C=C/C=C(\C=C/C)N(c1ccc(C)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H20BrN/c1-4-6-18(7-5-2)22(19-12-8-16(3)9-13-19)20-14-10-17(21)11-15-20/h4-15H,1H2,2-3H3/b7-5-,18-6+ |
| InChIKey | OUUUJOGXTCPJBE-SRRQOFNWSA-N |
| XLogP | 6.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|