C22H25N — CID 88960776
4-methyl-N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-N-(4-methylphenyl)aniline (PubChem CID 88960776) has the molecular formula C22H25N and a molecular weight of 303.45 g/mol. Its IUPAC name is 4-methyl-N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-N-(4-methylphenyl)aniline.
| Compound Name | 4-methyl-N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-N-(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 88960776 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 4-methyl-N-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-N-(4-methylphenyl)aniline |
| SMILES | C=C(C)/C=C\C(=C/C)N(c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H25N/c1-6-20(12-7-17(2)3)23(21-13-8-18(4)9-14-21)22-15-10-19(5)11-16-22/h6-16H,2H2,1,3-5H3/b12-7-,20-6+ |
| InChIKey | LSVZNQIGBMOYIR-GNJQMCHPSA-N |
| XLogP | 6.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|