C32H30N2O — CID 143685205
4-[4-(N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-phenylanilino)-N-methylanilino]phenol (PubChem CID 143685205) has the molecular formula C32H30N2O and a molecular weight of 458.61 g/mol. Its IUPAC name is 4-[4-(N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-phenylanilino)-N-methylanilino]phenol.
| Compound Name | 4-[4-(N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-phenylanilino)-N-methylanilino]phenol |
|---|---|
| PubChem CID | 143685205 |
| Molecular Formula | C32H30N2O |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 4-[4-(N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-phenylanilino)-N-methylanilino]phenol |
| SMILES | C=C/C=C(\C=C/C)N(c1ccc(N(C)c2ccc(O)cc2)cc1)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C32H30N2O/c1-4-10-29(11-5-2)34(31-15-9-14-26(24-31)25-12-7-6-8-13-25)30-18-16-27(17-19-30)33(3)28-20-22-32(35)23-21-28/h4-24,35H,1H2,2-3H3/b11-5-,29-10+ |
| InChIKey | JBLCUERQWHYDCX-MDDAIVICSA-N |
| XLogP | 8.61 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|