C49H48N2 — CID 144918413
ethane;N-[4-[4-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]-naphthalen-1-ylamino]phenyl]phenyl]-N-phenylnaphthalen-1-amine (PubChem CID 144918413) has the molecular formula C49H48N2 and a molecular weight of 664.94 g/mol. Its IUPAC name is ethane;N-[4-[4-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]-naphthalen-1-ylamino]phenyl]phenyl]-N-phenylnaphthalen-1-amine.
| Compound Name | ethane;N-[4-[4-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]-naphthalen-1-ylamino]phenyl]phenyl]-N-phenylnaphthalen-1-amine |
|---|---|
| PubChem CID | 144918413 |
| Molecular Formula | C49H48N2 |
| Molecular Weight | 664.94 g/mol |
| Exact Mass | 664.38 |
| IUPAC Name | ethane;N-[4-[4-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]-naphthalen-1-ylamino]phenyl]phenyl]-N-phenylnaphthalen-1-amine |
| SMILES | C=C/C=C(\C=C/C)N(c1ccc(-c2ccc(N(c3ccccc3)c3cccc4ccccc34)cc2)cc1)c1cccc2ccccc12.CC.CC |
| InChI | InChI=1S/C45H36N2.2C2H6/c1-3-14-38(15-4-2)46(44-24-12-18-36-16-8-10-22-42(36)44)40-30-26-34(27-31-40)35-28-32-41(33-29-35)47(39-20-6-5-7-21-39)45-25-13-19-37-17-9-11-23-43(37)45;2*1-2/h3-33H,1H2,2H3;2*1-2H3/b15-4-,38-14+;; |
| InChIKey | RPTPBQGXSXTPMV-IUOXTCCXSA-N |
| XLogP | 14.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.94 |
| LogP ≤ 5 | 14.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|