C50H42N2 — CID 145407742
N-[4-[2-[4-[2,3-bis(ethenyl)-N-[(2E,4Z)-hexa-2,4-dien-3-yl]anilino]phenyl]phenyl]phenyl]-N-phenylnaphthalen-1-amine (PubChem CID 145407742) has the molecular formula C50H42N2 and a molecular weight of 670.90 g/mol. Its IUPAC name is N-[4-[2-[4-[2,3-bis(ethenyl)-N-[(2E,4Z)-hexa-2,4-dien-3-yl]anilino]phenyl]phenyl]phenyl]-N-phenylnaphthalen-1-amine.
| Compound Name | N-[4-[2-[4-[2,3-bis(ethenyl)-N-[(2E,4Z)-hexa-2,4-dien-3-yl]anilino]phenyl]phenyl]phenyl]-N-phenylnaphthalen-1-amine |
|---|---|
| PubChem CID | 145407742 |
| Molecular Formula | C50H42N2 |
| Molecular Weight | 670.90 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | N-[4-[2-[4-[2,3-bis(ethenyl)-N-[(2E,4Z)-hexa-2,4-dien-3-yl]anilino]phenyl]phenyl]phenyl]-N-phenylnaphthalen-1-amine |
| SMILES | C=Cc1cccc(N(C(/C=C\C)=C/C)c2ccc(-c3ccccc3-c3ccc(N(c4ccccc4)c4cccc5ccccc45)cc3)cc2)c1C=C |
| InChI | InChI=1S/C50H42N2/c1-5-18-41(7-3)51(49-27-16-20-37(6-2)45(49)8-4)43-33-29-39(30-34-43)46-24-14-15-25-47(46)40-31-35-44(36-32-40)52(42-22-10-9-11-23-42)50-28-17-21-38-19-12-13-26-48(38)50/h5-36H,2,4H2,1,3H3/b18-5-,41-7+ |
| InChIKey | WVZNIEOYBJGVOW-GGORBUDQSA-N |
| XLogP | 14.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.90 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|