C49H36N2S2 — CID 167093363
N-[4-[4-[dibenzothiophen-3-yl-[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]phenyl]phenyl]-N-phenyldibenzothiophen-3-amine (PubChem CID 167093363) has the molecular formula C49H36N2S2 and a molecular weight of 716.98 g/mol. Its IUPAC name is N-[4-[4-[dibenzothiophen-3-yl-[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]phenyl]phenyl]-N-phenyldibenzothiophen-3-amine.
| Compound Name | N-[4-[4-[dibenzothiophen-3-yl-[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]phenyl]phenyl]-N-phenyldibenzothiophen-3-amine |
|---|---|
| PubChem CID | 167093363 |
| Molecular Formula | C49H36N2S2 |
| Molecular Weight | 716.98 g/mol |
| Exact Mass | 716.23 |
| IUPAC Name | N-[4-[4-[dibenzothiophen-3-yl-[(3E,5Z)-hepta-1,3,5-trien-4-yl]amino]phenyl]phenyl]-N-phenyldibenzothiophen-3-amine |
| SMILES | C=C/C=C(\C=C/C)N(c1ccc(-c2ccc(N(c3ccccc3)c3ccc4c(c3)sc3ccccc34)cc2)cc1)c1ccc2c(c1)sc1ccccc12 |
| InChI | InChI=1S/C49H36N2S2/c1-3-12-36(13-4-2)50(40-28-30-44-42-16-8-10-18-46(42)52-48(44)32-40)38-24-20-34(21-25-38)35-22-26-39(27-23-35)51(37-14-6-5-7-15-37)41-29-31-45-43-17-9-11-19-47(43)53-49(45)33-41/h3-33H,1H2,2H3/b13-4-,36-12+ |
| InChIKey | PHWLGMDUCBMHQH-JELDEAOBSA-N |
| XLogP | 15.34 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.98 |
| LogP ≤ 5 | 15.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|