C67H57N3S — CID 145448362
3-N-dibenzothiophen-3-yl-1-N,1-N-diphenyl-3-N-[3-(4-phenyl-N-(3-phenylphenyl)anilino)phenyl]benzene-1,3-diamine;ethane;(3Z)-penta-1,3-diene (PubChem CID 145448362) has the molecular formula C67H57N3S and a molecular weight of 936.28 g/mol. Its IUPAC name is 3-N-dibenzothiophen-3-yl-1-N,1-N-diphenyl-3-N-[3-(4-phenyl-N-(3-phenylphenyl)anilino)phenyl]benzene-1,3-diamine;ethane;(3Z)-penta-1,3-diene.
| Compound Name | 3-N-dibenzothiophen-3-yl-1-N,1-N-diphenyl-3-N-[3-(4-phenyl-N-(3-phenylphenyl)anilino)phenyl]benzene-1,3-diamine;ethane;(3Z)-penta-1,3-diene |
|---|---|
| PubChem CID | 145448362 |
| Molecular Formula | C67H57N3S |
| Molecular Weight | 936.28 g/mol |
| Exact Mass | 935.43 |
| IUPAC Name | 3-N-dibenzothiophen-3-yl-1-N,1-N-diphenyl-3-N-[3-(4-phenyl-N-(3-phenylphenyl)anilino)phenyl]benzene-1,3-diamine;ethane;(3Z)-penta-1,3-diene |
| SMILES | C=C/C=C\C.CC.c1ccc(-c2ccc(N(c3cccc(-c4ccccc4)c3)c3cccc(N(c4cccc(N(c5ccccc5)c5ccccc5)c4)c4ccc5c(c4)sc4ccccc45)c3)cc2)cc1 |
| InChI | InChI=1S/C60H43N3S.C5H8.C2H6/c1-5-18-44(19-6-1)46-34-36-50(37-35-46)62(51-27-15-22-47(40-51)45-20-7-2-8-21-45)53-29-17-31-55(42-53)63(56-38-39-58-57-32-13-14-33-59(57)64-60(58)43-56)54-30-16-28-52(41-54)61(48-23-9-3-10-24-48)49-25-11-4-12-26-49;1-3-5-4-2;1-2/h1-43H;3-5H,1H2,2H3;1-2H3/b;5-4-; |
| InChIKey | HZZQBNUUINSYDK-FXHNQCOHSA-N |
| XLogP | 20.57 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.28 |
| LogP ≤ 5 | 20.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|