C33H31N3 — CID 142805129
ethane;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-(1,10-phenanthrolin-3-yl)-N-phenylaniline (PubChem CID 142805129) has the molecular formula C33H31N3 and a molecular weight of 469.63 g/mol. Its IUPAC name is ethane;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-(1,10-phenanthrolin-3-yl)-N-phenylaniline.
| Compound Name | ethane;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-(1,10-phenanthrolin-3-yl)-N-phenylaniline |
|---|---|
| PubChem CID | 142805129 |
| Molecular Formula | C33H31N3 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | ethane;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-(1,10-phenanthrolin-3-yl)-N-phenylaniline |
| SMILES | C=C/C=C(\C=C/C)N(c1ccccc1)c1ccc(-c2cnc3c(ccc4cccnc43)c2)cc1.CC |
| InChI | InChI=1S/C31H25N3.C2H6/c1-3-9-27(10-4-2)34(28-12-6-5-7-13-28)29-18-16-23(17-19-29)26-21-25-15-14-24-11-8-20-32-30(24)31(25)33-22-26;1-2/h3-22H,1H2,2H3;1-2H3/b10-4-,27-9+; |
| InChIKey | VSVHRDCFIOMHNK-ZZZYLQKCSA-N |
| XLogP | 9.26 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|